View source for Dichloroisocyanuric acid

{{chembox
|   Name = Dichloroisocyanuric acid
|   ImageFileL1 = Troclosene.svg
|   ImageSizeL1 = 120px
|   ImageNameL1 = Dichlor
|   ImageFileR1 = Troclosene3d.png
|   ImageSizeR1 = 140px
|   ImageNameR1 = Dichlor
|   IUPACName = 1,3-dichloro-1,3,5-triazinane-2,4,6-trione
| Section1 = {{Chembox Identifiers
|   CASNo = 2782-57-2
|   SMILES = C1(=O)NC(=O)N(C(=O)N1Cl)Cl
  }}
| Section2 = {{Chembox Properties
|   Formula = C<sub>3</sub>HCl<sub>2</sub>N<sub>3</sub>O<sub>3</sub>
|   MolarMass = 197.96 g/mol
|   Density = 2.2 g/cm<sup>3</sup>
|   MeltingPt = 225 °C
  }}
}}

'''Dichloroisocyanuric acid''', also known as '''dichlor''' or '''dichloro-s-triazinetrione''' and which marketed under many names (e.g. '''troclosene'''), is a [[chemical compound]] with the formula (C(O)NCl)<sub>2</sub>(C(O)NH).  This colourless solid is the active ingredient in commercial bacteriocides, algicides, and cleaning agents.  It is an oxidizer that reacts with water to form [[hypochlorous acid]], a compound related to the active ingredient in [[bleach]].

It is manufactured by [[chlorination]] of [[cyanuric acid]]:<ref name=Ullmann>Klaus Huthmacher, Dieter Most "Cyanuric Acid and Cyanuric Chloride" Ullmann's Encyclopedia of Industrial Chemistry" 2005, Wiley-VCH, Weinheim. ISBN 10.1002/14356007.a08 191</ref> 
:(C(O)NH)<sub>3</sub>  +  2 Cl<sub>2</sub>   →   (C(O)NCl)<sub>2</sub>(C(O)NH)  +  2 HCl

The sodium salt of dichloroisocyanuric acid, [[sodium dichloroisocyanurate]], is the active ingredient in the powderized cleanser [[Comet (cleanser)|Comet]] and is also used as a pool disinfectant.

==See also==
*[[Trichloroisocyanuric acid]] (trichlor)

==References==
<references/>

[[Category:Antimicrobials]]
[[Category:Organochlorides]]
[[Category:Organic acids]]
[[Category:Bleaches]]
[[Category:Ureas]]
[[Category:Triazines]]

[[de:Dichlorisocyanursäure]]
[[Category:2Fix]]