View source for 4C-T-2

{{Drugbox
| IUPAC_name               = 1-[(2,5-dimethoxy-4-ethylthio)phenyl)butan-2-amine
| image                    = 4C-T-2 skeletal.svg
| CAS_number               = 
| ATC_prefix               = none
| ATC_suffix               = 
| PubChem                  = 11197523
| C = 14 | H = 23 | N = 1 | O = 2 | S = 1
| molecular_weight         = 269.4 g/mol
| smiles                   = COc1cc(SCC)c(OC)cc1CC(N)CC
| bioavailability          = 
| protein_bound            = 
| metabolism               = 
| elimination_half-life    = 
| excretion                = 
| pregnancy_category       = 
| legal_status             = Uncontrolled
| routes_of_administratin  = 
}}

'''2,5-Dimethoxy-4-ethylthio-α-ethylphenethylamine''' ('''4C-T-2''') is a [[chemical synthesis|synthetic drug]] of the [[substituted phenethylamine|phenethylamine]] [[chemical class]]. It is the [[alpha carbon|α]]-[[ethyl group|ethylated]] [[analogue (chemistry)|analogue]] of [[2C-T-2]].

== Pharmacology ==

=== Binding profile ===

4C-T-2 has [[affinity (pharmacology)|affinity]] (K<sub>i</sub>) for the [[5-HT1A receptor|5-HT<sub>1A</sub>]] (5,339 nM), [[5-HT1E receptor|5-HT<sub>1E</sub>]] (9,879 nM), [[5-HT2A receptor|5-HT<sub>2A</sub>]] (274.1 nM), [[5-HT2B receptor|5-HT<sub>2B</sub>]] (58.1 nM), [[5-HT2C receptor|5-HT<sub>2C</sub>]] (468.6 nM), [[5-HT5A receptor|5-HT<sub>5A</sub>]] (1,587 nM), [[5-HT7 receptor|5-HT<sub>7</sub>]] (3,829), [[D3 receptor|D<sub>3</sub>]] (1,273 nM), [[β2-adrenergic receptor|β<sub>2</sub>-adrenergic]] (124.9 nM), [[Imidazoline-1 receptor|I<sub>1</sub>]] (946.5 nM), and [[Sigma-1 receptor|σ<sub>1</sub>]] (514 nM) [[receptor (biochemistry)|receptor]]s.<ref name="pmid20126400">{{cite journal | author = Ray TS | title = Psychedelics and the human receptorome | journal = Plos One | volume = 5 | issue = 2 | pages = e9019 | year = 2010 | pmid = 20126400 | doi = 10.1371/journal.pone.0009019 | url = }}</ref> The [[intrinsic activity|activity]] of 4C-T-2 at these sites has not been assayed, with the exception of the 5-HT<sub>2A</sub> and 5-HT<sub>2C</sub> receptors where it acts as a [[partial agonist]].<ref name="pmid20126400">{{cite journal | author = Ray TS | title = Psychedelics and the human receptorome | journal = Plos One | volume = 5 | issue = 2 | pages = e9019 | year = 2010 | pmid = 20126400 | doi = 10.1371/journal.pone.0009019 | url = }}</ref>

== See also ==
* [[2C-T-2]]
* [[Aleph_(psychedelic)#Aleph-7|Aleph-7]]
* [[Ariadne (psychedelic)|Ariadne]]

== References ==
{{Reflist}}


{{Adrenergics}}
{{Dopaminergics}}
{{Serotonergics}}
{{Sigmaergics}}
{{Phenethylamines}}


{{pharmacology-stub}}
[[Category:2Fix]]