View source for Alphamethylthiofentanyl

{{drugbox |
| IUPAC_name        = ''N''-phenyl-''N''-[1-(1-thiophen-2-ylpropan-2-yl)-4-piperidyl]propanamide
| image             = alphamethylthiofentanyl.svg
| width             = 100
| ChemSpiderID = 56104
| InChI = 1/C21H28N2OS/c1-3-21(24)23(18-8-5-4-6-9-18)19-11-13-22(14-12-19)17(2)16-20-10-7-15-25-20/h4-10,15,17,19H,3,11-14,16H2,1-2H3
| smiles = O=C(N(c1ccccc1)C2CCN(CC2)C(Cc3sccc3)C)CC
| InChIKey = YPOXDUYRRSUFFG-UHFFFAOYAY
| CAS_number        = 103963-66-2
| synonyms  = α-methyl-thiofentanyl
| ATC_prefix        = none
| ATC_suffix        = 
| PubChem           = 62309
| DrugBank          = 
| C = 21 | H = 28 | N = 2 | O = 1 | S = 1
| molecular_weight  = 356.526 g/mol
| bioavailability   = 
| protein_bound     = 
| metabolism        = 
| elimination_half-life = 
| excretion         = 
| pregnancy_AU      =  <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US      =  <!-- A / B            / C / D / X -->
| pregnancy_category=  
| legal_AU          =  <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA          =  Schedule I
| legal_UK          =  Class A
| legal_US          =  Schedule I
| legal_status      = 
| routes_of_administration = 
}}

'''α-methyl-thiofentanyl''' is an [[opioid]] [[analgesic]] that is an [[analog (chemistry)|analogue]] of [[fentanyl]]. 

α-methyl-thiofentanyl was sold briefly on the black market in the early 1980s, before the introduction of the [[Federal Analog Act]] which for the first time attempted to control entire families of drugs based on their structural similarity rather than scheduling each drug individually as they appeared. <ref> Henderson GL. Designer Drugs: Past History and Future Prospects. Journal of Forensic Sciences 1988; 33(2):569-575 </ref> 

α-methyl-thiofentanyl has similar effects to fentanyl. Side effects of fentanyl analogues are similar to those of fentanyl itself, which include [[itching]], [[nausea]] and potentially serious [[respiratory depression]] which can be life-threatening.

== References ==
<references />

{{Opioids}}

[[Category:Opioids]]
[[Category:Thiophenes]]
[[Category:Piperidines]]
[[Category:Anilides]]
[[Category:Propionamides]]

{{analgesic-stub}}

[[sv:Alfametyltiofentanyl]]
[[zh:阿法甲基硫代芬太尼]]
[[Category:2Fix]]