View source for BCDMH

{{chembox
| verifiedrevid = 321965401
|   Name = BCDMH
|   ImageFile = BCDMH.png
<!-- | ImageSize = 150px -->
|   ImageName = BCDMH
|   IUPACName = 1-bromo-3-chloro-5,5-dimethylimidazolidine-2,4-dione
|   OtherNames = bromochloro-5,5-dimethylhydantoin, BCDMH, agribrom, aquabrom, aquabrome, bromicide, di-halo, halogene T30, nylate, photobrome, slimicide 78P
| Section1 = {{Chembox Identifiers
|   InChI = 1/C5H6BrClN2O2/c1-5(2)3(10)8(6)4(11)9(5)7/h1-2H3
| InChIKey = PQRDTUFVDILINV-UHFFFAOYAT
| PubChem = 31335
| CASNo_Ref = {{cascite}}
| CASNo = 16079-88-2
|   SMILES = O=C1N(Br)C(=O)N(Cl)C1(C)C
| ChemSpiderID=29069
  }}
| Section2 = {{Chembox Properties
|   Formula = C<sub>5</sub>H<sub>6</sub>BrClN<sub>2</sub>O<sub>2</sub>
|   MolarMass = 241.47 g/mol
|   Appearance = White solid
|   Density = 1.9 g/cm<sup>3</sup>
|   Solubility = 0.15 g/100 ml (25 °C)
|   MeltingPt = 159–163 °C
|   BoilingPt = 
  }}
| Section7 = {{Chembox Hazards
|   ExternalMSDS = [http://physchem.ox.ac.uk/MSDS/BR/1-bromo-3-chloro-5,5-dimethyl-2,4-imidazolidinedione.html External MSDS]
|   MainHazards = Flamability, Inhalation
|   NFPA-H = 3
|   NFPA-R = 1
|   NFPA-F = 1
|   FlashPt = Decomposes at 160°C
|   RSPhrases = {{S8}}, {{S17}}, {{S26}}, {{S36}}, {{S37}}, {{S39}}, {{S41}}, {{S45}}
  }}
}}

'''1-Bromo-3-chloro-5,5-dimethylhydantoin''' ('''BCDMH''') is a chemical structurally related to [[hydantoin]]. It is a white crystalline compound with a slight [[bromine]] and [[acetone]] odor and is insoluble in water, but soluble in [[acetone]].

BCDMH is an excellent source of both chlorine and bromine as it reacts slowly with water releasing [[hypochlorous acid]] and [[hypobromous acid]]. It used as a chemical [[disinfectant]] used for recreational water and drinking [[water purification]]. BCDMH works in the following manner<ref>South Australian Health Commission, "Standard for the Operation of Swimming Pools and Spa Pools in South Australia",  [http://www.dh.sa.gov.au/pehs/publications/code-bromine.pdf Supplement C: Bromine Disinfection], page 8. Retrieved on 2009-05-12.</ref>:

The initial BCDMH reacts with water (R = Dimethylhydantoin):

: BrClR + 2 H<sub>2</sub>O → [[hypobromous acid|HOBr]] + [[hypochlorous acid|HOCl]] + RH<sub>2</sub>

Hypobromous acid partially dissociates in water:

: HOBr → H<sup>+</sup> + OBr<sup>-</sup>

Hypobromous acid oxidizes the substrate, itself being reduced to bromide:

: HOBr + Live pathogens → Br<sup>-</sup> + Dead pathogens

The bromide ions are oxidized with the hypochlorous acid that was formed from the initial BCDMH:

: Br<sup>-</sup> + HOCl → HOBr + Cl<sup>-</sup>

This produces more hypobromous acid. However, the hypochlorous acid itself does act directly as a disinfectant in the process.

==References==
{{reflist}}

== External links ==
* [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=61828&loc=ec_rcs PubChem Public Chemical Database (nih.gov)]
* [http://www.e1.greatlakes.com/common/msdspdf/00255.pdf External MSDS]

[[Category:Disinfectants]]
[[Category:Organobromides]]
[[Category:Organochlorides]]
[[Category:Hydantoins]]

[[ja:1-ブロモ-3-クロロ-5,5-ジメチルヒダントイン]]
[[ru:1-бром-3-хлор-5,5-диметилгидантоин]]
[[Category:2Fix]]