View source for Cinoxate

{{chembox
|   Reference=<ref>''[[Merck Index]]'', 11th Edition, '''2312'''.</ref>
|   Name = Cinoxate
|   ImageFile = cinoxate.png
<!-- | ImageSize = 180px -->
|   ImageName = 
|   IUPACName = 2-Ethoxyethyl 3-(4-<br />methoxyphenyl)propenoate
|   OtherNames = Cinoxate<br />2-Ethoxyethyl ''p''-methoxycinnamate
| Section1 = {{Chembox Identifiers
|   ChemSpiderID = 4523729
| InChI = 1/C14H18O4/c1-3-17-10-11-18-14(15)9-6-12-4-7-13(16-2)8-5-12/h4-9H,3,10-11H2,1-2H3/b9-6+
| InChIKey = CMDKPGRTAQVGFQ-RMKNXTFCBV
| PubChem = 5373773
| CASNo = 104-28-9
|   SMILES = O=C(OCCOCC)\C=C\c1ccc(OC)cc1
}}
| Section2 = {{Chembox Properties
|   Formula = C<sub>14</sub>H<sub>18</sub>O<sub>4</sub>
|   MolarMass = 250.28 g/mol
|   Density = 1.102 g/cm<sup>3</sup>
|   MeltingPt = -25 °C
|   BoilingPt = 184-187 °C at 2 mmHg
  }}
}}

'''Cinoxate''' is an [[organic compound]] used as an ingredient in some types of [[sunscreen]]s.  It is an [[ester]] formed from [[methoxycinnamic acid]] and [[2-Ethoxyethanol|2-ethoxyethanol]].  It is a slightly yellow viscous liquid that is insoluble in water, but miscible with [[alcohol]]s, esters, and vegetable oils.

It protects skin against the sun by absorbing [[UV-A]]{{fact|date=January 2009}} and UV-B rays.

==See also==
*[[Octyl methoxycinnamate]], another methoxycinnamate-based sunscreen

==References==
<references/>

{{Sunscreening agents}}

[[Category:Sunscreening agents]]
[[Category:Phenol ethers]]
[[Category:Cinnamates]]


{{organic-compound-stub}}

[[nl:Cinoxaat]]
[[Category:2Fix]]