View source for LY-487,379

{{drugbox
| IUPAC_name        = N-(4-(2-methoxyphenoxy)phenyl)- N-(2,2,2-trifluoroethylsulfonyl)pyrid- 3-ylmethylamine
| image             = LY-487,379_structure.png
| width             = 200
| CAS_number        = 
| ATC_prefix        = none
| ATC_suffix        = 
| PubChem           = 9825084
| IUPHAR_ligand = 1402
| DrugBank          = 
| C=21|H=19|F=3|N=2|O=4|S=1
| molecular_weight  = 452.446 g/mol
| smiles            = c3ncccc3CN(S(=O)(=O)CC(F)(F)F)c2ccc(cc2)Oc1ccccc1OC
| bioavailability   = 
| protein_bound     = 
| metabolism        = 
| elimination_half-life = 
| excretion         = 
| pregnancy_AU      =  <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US      =  <!-- A / B            / C / D / X -->
| pregnancy_category=  
| legal_AU          =  <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA          =  <!--             / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK          =  <!-- GSL         / P       / POM / CD / Class A, B, C -->
| legal_US          =  <!-- OTC                   / Rx-only  / Schedule I, II, III, IV, V -->
| legal_status      = 
| routes_of_administration = 
}}

'''LY-487,379''' is a drug used in scientific research that acts as a selective [[Allosteric modulation|positive allosteric modulator]] for the [[metabotropic glutamate receptor]] group II subtype [[Metabotropic glutamate receptor 2|mGluR<sub>2</sub>]].<ref>{{Cite pmid|12852748}}</ref> It is used to study the structure and function of this receptor subtype,<ref>{{Cite journal | first1 = H.
| author2 = Rowe
| author3 =  Morales
| last1 = Schaffhauser | first2 = B. A. | first3 = S.
| last4 = Chavez-noriega
| last6 = Jachec
| author4 =  Chavez-noriega | first4 = L. E.
| author5 = Yin | first5 = R.
| last7 = Rao
| last5 = Yin
| last3 = Morales
| author6 = Jachec
| last2 = Rowe
| author1 =   | first6 = C.
| author7 =  Rao
| last9 = Pinkerton | first7 = S. P.
| author8 =  Bain | first8 = G.
| author9 =Pinkerton | first9 = A. B.
| title = Pharmacological Characterization and Identification of Amino Acids Involved in the Positive Modulation of Metabotropic Glutamate Receptor Subtype 2
| journal = Molecular Pharmacology
| volume = 64 | issue = 4
| pages = 798
| last8 = Bain
| year = 2003 | pmid = 14500736 | first10 = JM 
| doi = 10.1124/mol.64.4.798 
}}</ref><ref>{{Cite journal
| author1 =  | first1 = O.
| author2 = 
| last1 = Poisik | first2 = D. V.
| author3 =  | first3 = M.
| author4 =  | first4 = A.
| author5 =  | first5 = O. A.
| author6 =  | first6 = P. J.
| author7 =  | first7 = Y.
| title = Metabotropic glutamate receptor 2 modulates excitatory synaptic transmission in the rat globus pallidus
| journal = Neuropharmacology
| volume = 49
| pages = 57–50
| year = 2005 
| doi = 10.1016/j.neuropharm.2005.03.006
}}</ref> and LY-487,379 along with various other mGluR<sub>2/3</sub> agonists and positive modulators are being investigated as possible [[antipsychotic]] and [[anxiolytic]] drugs.<ref>{{Cite journal
| author1 =  | first1 = R. | first2 = N. G.
| author3 = 
| last1 = Galici
| author2 =  | first3 = A. L. | first4 = P. J.
| title = A Selective Allosteric Potentiator of Metabotropic Glutamate (mGlu) 2 Receptors Has Effects Similar to an Orthosteric mGlu2/3 Receptor Agonist in Mouse Models Predictive of Antipsychotic Activity
| journal = Journal of Pharmacology and Experimental Therapeutics
| last3 = Rodriguez
| volume = 315
| last4 = Conn
| pages = 1181
| year = 2005 
| doi = 10.1124/jpet.105.091074
| last2 = Echemendia
| author4 = 
}}</ref><ref>{{Cite pmid|16368268}}</ref><ref>{{Cite pmid|17318501}}</ref><ref>{{Cite pmid|190790739}}</ref>

==See also==
* [[Eglumegad]]
* [[HYDIA]]

== References ==
{{reflist}}

{{Glutamate_receptor_ligands}}
{{pharmacology-stub}}
[[Category:Eli Lilly and Company]]
[[Category:2Fix]]