View source for Muzolimine

{{Drugbox
| IUPAC_name        = 5-amino-2-[1-(3,4-dichlorophenyl)ethyl]-4H-pyrazol-3-one
| image             = Muzolimine.png
| CAS_number        = 
| ATC_prefix        = none
| ATC_suffix        = 
| PubChem           = 41386
| DrugBank          = 
| chemical_formula  = 
| C=11 | H=11 | Cl=2 | N=3 | O=1
| molecular_weight  = 272.13 g/mol
| smiles            = CC(C1=CC(=C(C=C1)Cl)Cl)N2C(=O)CC(=N2)N
| bioavailability   = 
| protein_bound     = 
| metabolism        = 
| elimination_half-life = 
| excretion         = 
| pregnancy_AU      =  <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US      =  <!-- A / B            / C / D / X -->
| pregnancy_category=  
| legal_AU =  <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA =  <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK =  <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US =  <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status      = 
| routes_of_administration = 
}}

'''Muzolimine''' is a [[diuretic]].



{{Diuretics}}

[[Category:Diuretics]]
[[Category:Organochlorides]]
[[Category:Pyrazolones]]
A Pyrazole diuretic which was used for treatment of Hypertension but was withdrawn worldwide because of severe neurological side effects.


{{cardiovascular-drug-stub}}
[[Category:2Fix]]