View source for Norbaeocystin

{{drugbox |
| IUPAC_name = 3-(2-ammonioethyl)-1''H''-indol-4-yl hydrogen phosphate
| image = Norbaeocystin.png
| width = 140
| CAS_number = 
| ATC_prefix = none
| ATC_suffix = 
| PubChem = 
| C=10 | H=13 | N=2 | O=4 | P=1
| molecular_weight = 256.19 g/mol
| smiles = [NH3+]CCC1=CNC2=C1C(OP([O-])(O)=O)=CC=C2
| melting_point = 
| melting_high = 
| bioavailability = 
| protein_bound = 
| metabolism = 
| elimination_half-life = 
| excretion = 
| pregnancy_AU =  
| pregnancy_US = 
| pregnancy_category =  
| legal_AU = 
| legal_CA = 
| legal_UK = 
| legal_US = Schedule I Analogue.
| legal_status = 
| routes_of_administration = Oral, Other R.O.A. N/A
}}

'''Norbaeocystin''' is a [[mushroom]] [[alkaloid]] and [[analog (chemistry)|analog]] of the [[psychedelic]] [[Psychedelics, dissociatives and deliriants|hallucinogenic drug]] [[psilocybin]]. It is found as a minor compound in most psilocybin mushrooms together with [[psilocin]], [[psilocybin]] and [[baeocystin]].  It is not known if this base contributes to the [[entheogen]]ic effects the mushroom.

== See also ==
* [[Baeocystin]]
* [[Psilocin]]
* [[Psilocybin]]

== References ==
{{Unreferenced|date=August 2009}}
{{Reflist|2}}

{{Tryptamines}}

[[Category:Natural tryptamine alkaloids]]
[[Category:Psychedelic tryptamines]]
[[Category:Organophosphates]]


{{pharm-stub}}

[[de:Norbaeocystin]]
[[fr:Norbaeocystine]]
[[fi:Norbaeosystiini]]
[[sv:Norbaeocystin]]
[[Category:2Fix]]