View source for O-806

{{Drugbox|
|IUPAC_name = (6aR)-3-(6-bromohex-2-ynyl)-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol
| image = O-806.png
| width= 240
| CAS_number= 
| ATC_prefix=
| ATC_suffix=
| PubChem= 10549140
| DrugBank=
| C=22 | H=27 | Br=1 | O=2
| molecular_weight = 403.352 g/mol
| smiles = C3C1C(CC=C3C)C(C)(C)Oc(c2)c1c(O)cc2CC#CCCCBr
| bioavailability=
| metabolism = 
| elimination_half-life= 
| excretion = 
| pregnancy_category =
| legal_status = 
| routes_of_administration= 
}}

'''O-806''' is a drug which is a [[cannabinoid]] derivative that is used in scientific research. It is described as a mixed agonist/antagonist at the cannabinoid [[Receptor (biochemistry)|receptor]] [[cannabinoid receptor 1|CB<sub>1</sub>]], meaning that it acts as an antagonist when co-administered alongside a more potent CB<sub>1</sub> agonist, but exhibits weak partial agonist effects when administered by itself.<ref>{{Cite pmid|10323589}}</ref><ref>{{Cite pmid|10516649}}</ref>

{{cannabinoid-stub}}

==References==
<references/>

{{cannabinoids}}
[[Category:Cannabinoids]]
[[Category:Benzochromenes]]
[[Category:Phenols]]
[[Category:Alkynes]]
[[Category:Organobromides]]
[[Category:2Fix]]