View source for Pyrimidinylpiperazine

{{Chembox
| ImageFile = Pyrimidinylpiperazine.png
| ImageSize = 
| IUPACName = 2-(piperazin-1-yl)pyrimidine
| OtherNames = 
| Section1 = {{Chembox Identifiers
|  CASNo = 
|  PubChem = 88747
|  ChemSpiderID = 80080
|  SMILES = n1cccnc1N2CCNCC2
|  InChI = InChI=1S/C8H12N4/c1-2-10-8(11-3-1)12-6-4-9-5-7-12/h1-3,9H,4-7H2
  }}
| Section2 = {{Chembox Properties
|  Formula = C<sub>8</sub>H<sub>12</sub>N<sub>4</sub>
|  MolarMass = 164.21 g/mol
|  Appearance = 
|  Density = 
|  MeltingPt = 
|  BoilingPt = 
|  Solubility =
  }}
| Section3 = {{Chembox Hazards
|  MainHazards = 
|  FlashPt = 
|  Autoignition =
  }}
}}

'''1-(2-Pyrimidinyl)piperazine''' ('''1-PP''', '''1-PmP''') is a [[chemical compound]] and [[piperazine]] [[chemical derivative|derivative]]. It is known to act as an [[α2-adrenergic|α<sub>2</sub>-adrenergic receptor]] [[receptor_antagonist|antagonist]],<ref name="pmid1681447">{{Cite pmid|1681447}}</ref> and as a [[5-HT1A_receptor|5-HT<sub>1A</sub> receptor]] [[partial agonist]] to a much lesser extent.<ref name="pmid12438536">{{Cite pmid|12438536}}</ref> It does not appear to have any significant affinity for the [[D2_receptor|D<sub>2</sub>]] or [[α1-adrenergic|α<sub>1</sub>-adrenergic receptor]]s.

A number of pyrimidinylpiperazine derivatives are [[drug]]s, including:

* [[Buspirone]] - Anxiolytic
* [[Dasatinib]] - Anticancer agent
* [[Eptapirone]] - Anxiolytic
* [[Gepirone]] - Anxiolytic
* [[Ipsapirone]] - Anxiolytic
* [[Piribedil]] - Antiparkinsonian agent
* [[Revospirone]] - Anxiolytic
* [[Tandospirone]] - Anxiolytic
* [[Tirilazad]] - Alpha blocker
* [[Umespirone]] - Anxiolytic
* [[Zalospirone]] - Anxiolytic

The [[anxiolytic]]s are also classified as [[azapirone]]s due to the azaspirodecanedione moiety in their structures. 1-PP is a common [[metabolite]] of most or all of the listed agents.<ref name="pmid1681447">{{Cite pmid|1681447}}</ref><ref name="pmid12505530">{{Cite pmid|12505530}}</ref> [[Alnespirone]], [[binospirone]], and [[enilospirone]], despite being azapirones, are not piperazines and therefore do not metabolize to 1-PP, and while [[perospirone]] and [[tiospirone]] are piperazines, they are instead [[benzothiazole]]-substituted piperazines and do not metabolize to 1-PP either.

== See also ==
* [[Pyridinylpiperazine]]
* [[Phenylpiperazine]]
* [[Diphenylmethylpiperazine]]
* [[Benzylpiperazine]]

== References ==
{{Reflist}}


{{Adrenergics}}
{{Serotonergics}}
{{Piperazines}}

[[Category:Piperazines]]
[[Category:Pyrimidines]]


{{organic-compound-stub}}
[[Category:2Fix]]