Search results

...Hydrate Filler in Polyester Systems. ''Mod. Plastics'' '''1965,''' ''43'' (2), 154-202.</ref> while synthesizing intrinsically fire-resistant [[polymers ...cleURL&_udi=B6TXS-48HY9B8-99&_user=7379334&_coverDate=12%2F31%2F1991&_rdoc=2&_fmt=high&_orig=browse&_srch=doc-info(%23toc%235598%231991%23999669997%2342

| CASNo = 71-43-2 | InChI = 1/C6H6/c1-2-4-6-5-3-1/h1-6H

...ing units and fasten to the central atom so as to produce [[heterocyclic]] rings."<br />{{cite journal | journal = [[J. Chem. Soc., Trans.]] | year = 1920 | [[Image:Cu chelate.png|thumb|Cu²⁺ [[Coordination complex|complexes]] with [[methylamine]] (left) ''and

...ical structure]], shown at right, essentially consists of four [[pyrrole]] rings joined together by four methine (=[[Carbon|C]][[Hydrogen|H]]&mdash;) [[func ...nd the perimeter of the macrocycle ring, there is a cyclic chain of sp² [[Orbital hybridisation|hybridized]] [[carbon]] [[atom]]s, all of whi

| IUPACName = 2,6-bis(2-pyridyl)pyridine | InChI = InChI=1S/C15H11N3/c1-3-10-16-12(6-1)14-8-5-9-15(18-14)13-7-2-4-11-17-13/h1-11H

| OtherNames = 1H-Benzotriazol, 1,2,3-Benzotriazol, btaH ...ble in polar solvents, including water. Benzotriazoles are also a class of compounds containing the benzotriazole skeleton.

...c]]. That is, they obey [[Hückel's rule]] for aromaticity, possessing 4n+2 = &pi; electrons (n=4 for the shortest cyclic path) that are delocalized ov ...omplex (chemistry)|complexes]]. The metal [[ion]] usually has a charge of 2+ or 3+. A schematic equation for these syntheses is shown:

'''Tetraphenylporphyrin''', abbreviated H₂TPP, is a synthetic [[heterocyclic compound]] that resembles naturally occurring [[porphyrin]]s. Porphyrins a ...rphine | year = 1967 | journal = [[J. Org. Chem.]] | volume = 32 | issue = 2 | pages = 476–476 | doi = 10.1021/jo01288a053 }}</ref>

...n]] atom is ''"[[sandwich]]ed"'' between two parallel [[cyclopentadienyl]] rings. [[F. Albert Cotton|Cotton]] later proposed the term ''hapticity'' derived === Historically important compounds where the ligands are described with hapticity ===