Search results

...'Technical Papers of the Annual Technical Conference'' '''1996,''' ''54'' (3), 3068-3071.</ref> Fire-safe [[polymers]] also find application as [[adhesi ...0001750/abstract DOI: 10.1002/(SICI)1097-4628(20000411)76:2<240::AID-APP13>3.0.CO;2-A]</ref> Polyimides, polybenzoxazoles (PBOs), polybenzimidazoles, an

| OtherNames = Benzol<br />cyclohexa-1,3,5-triene | InChI = 1/C6H6/c1-2-4-6-5-3-1/h1-6H

...ing units and fasten to the central atom so as to produce [[heterocyclic]] rings."<br />{{cite journal | journal = [[J. Chem. Soc., Trans.]] | year = 1920 | ...rings so the concentration of the [[EDTA]] complex, which has six chelate rings, is much much higher than a corresponding complex with two monodentate nitr

| SMILES=c1cc2cc3ccc(cc4ccc(cc5ccc(cc1n2)[nH]5)n4)[nH]3 ...ical structure]], shown at right, essentially consists of four [[pyrrole]] rings joined together by four methine (=[[Carbon|C]][[Hydrogen|H]]&mdash;) [[func

| InChI = InChI=1S/C15H11N3/c1-3-10-16-12(6-1)14-8-5-9-15(18-14)13-7-2-4-11-17-13/h1-11H | C=15 | H=11 | N=3

| OtherNames = 1H-Benzotriazol, 1,2,3-Benzotriazol, btaH |C=6|H=5|N=3

...d [[blood cell]]s. Heme is a cofactor of the protein hemoglobin. They are heterocyclic [[macrocycle]]s composed of four modified [[pyrrole]] subunits interconnect ...(chemistry)|complexes]]. The metal [[ion]] usually has a charge of 2+ or 3+. A schematic equation for these syntheses is shown:

| Density = 1.27 g/cm³ '''Tetraphenylporphyrin''', abbreviated H₂TPP, is a synthetic [[heterocyclic compound]] that resembles naturally occurring [[porphyrin]]s. Porphyrins a

...n]] atom is ''"[[sandwich]]ed"'' between two parallel [[cyclopentadienyl]] rings. [[F. Albert Cotton|Cotton]] later proposed the term ''hapticity'' derived === Historically important compounds where the ligands are described with hapticity ===