View source for Fluo-4

{{Chembox
|  ImageFile = Fluo-4.svg
|  ImageName = Fluo-4 Tetraanion
|  PIN = Fluo-4
|  SystematicName = 2-{[2-(2-{5-[bis(carboxymethyl)amino]-2-methylphenoxy}ethoxy)-4-(2,7-difluoro-6-hydroxy-3-oxo-3''H''-xanthen-9-yl)phenyl](carboxymethyl)amino}acetic acid
| Section1 = {{Chembox Identifiers
|  MeSHName = Fluo-4
|  ChEBI = 51103
|  SMILES = CC1=CC=C(C=C1OCCOC1=C(C=CC(=C1)C1=C2C=C(F)C(=O)C=C2OC2=C1C=C(F)C(O)=C2)N(CC(O)=O)CC(O)=O)N(CC(O)=O)CC(O)=O
|  InChI = 1S/C36H30F2N2O13/c1-18-2-4-20(39(14-32(43)44)15-33(45)46)9-28(18)51-6-7-52-31-8-19(3-5-25(31)40(16-34(47)48)17-35(49)50)36-21-10-23(37)26(41)12-29(21)53-30-13-27(42)24(38)11-22(30)36/h2-5,8-13,41H,6-7,14-17H2,1H3,(H,43,44)(H,45,46)(H,47,48)(H,49,50)}}
| Section2 = {{Chembox Properties
|  Formula = 
|  MolarMass = 
|  Appearance = 
|  Density = 
|  MeltingPt = 
|  BoilingPt = 
|  Solubility = }}
| Section3 = {{Chembox Hazards
|  MainHazards = 
|  FlashPt = 
|  Autoignition = }}
}}

'''Fluo-4''' is used to measure [[calcium in biology|calcium]] (Ca<sup>2+</sup>) concentrations inside living cells, and is often used for [[high-throughput screening]] of receptor ligands and calcium permeable ion channels.

The green-fluorescent calcium indicator, Fluo-4, is an improved version of the calcium indicator, Fluo-3. It is commonly used as the non-fluorescent [[acetoxymethyl ester]] (Fluo-4 AM) which is cleaved inside the cell to give the free, fluorescent Fluo-4. It loads faster, is brighter at equivalent concentrations and is well-excited by the 488&nbsp;nm line of the argon-ion laser which is often used in biological research laboratories.<ref name="pmid10756976">{{cite journal |author=Gee KR, Brown KA, Chen WN, Bishop-Stewart J, Gray D, Johnson I |title=Chemical and physiological characterization of fluo-4 Ca(2+)-indicator dyes |journal=Cell Calcium |volume=27 |issue=2 |pages=97–106 |year=2000 |month=February |pmid=10756976 |doi=10.1054/ceca.1999.0095 |url=}}</ref> The sole distributor and owner of the patents is [[Invitrogen]] which acquired the original inventor [[Molecular Probes]].

==References==
{{reflist}}

[[Category:Biochemistry methods]]
[[Category:Cell imaging]]
[[Category:Chelating agents]]
[[Category:Fluorescent dyes]]


{{organic-chem-stub}}
[[Category:2Fix]]