View source for Talarozole

{{Drugbox
| IUPAC_name        = N-(2-Benzothioazolyl)-N-[4-[2-ethyl-1-(1,2,4-triazo-1-yl)butyl]phenyl]amine
| image             = R115866 structure.svg
| CAS_number        = 201410-53-9
| CAS_supplemental  =
| ATC_prefix        = none
| ATC_suffix        = 
| ATC_supplemental  = 
| PubChem           = 9799888
| DrugBank          = 
| chemical_formula  = 
| C=21 | H=23 | N=5 | S=1
| molecular_weight  = 377.505 g/mol
| smiles            = c2ncnn2C(C(CC)CC)c(cc3)ccc3Nc4nc1ccccc1s4
| bioavailability   = 
| protein_bound     = 
| metabolism        = 
| elimination_half-life = 
| excretion         = 
| pregnancy_AU      =  <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US      =  <!-- A / B            / C / D / X -->
| pregnancy_category=  
| legal_AU =  <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA =  <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK =  <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US =  <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status      = 
| routes_of_administration = oral, topical
}}

'''Talarozole''' (formerly '''R115866''', planned trade name '''Rambazole''') is an investigational drug for the treatment of [[acne]], [[psoriasis]] and other [[keratinization]] disorders.

Talarozole inhibits the metabolism of [[retinoic acid]] by blocking the [[cytochrome P450]] enzyme isoform CYP26, a retinoic acid [[hydroxylase]]. Because of this mechanism, it is called a retinoic acid metabolism blocking agent (RAMBA).<ref>{{cite journal|last=Giltaire|first=S|coauthors=Herphelin F, Frankart A, Hérin M, Stoppie P, Poumay Y|date=11 December 2008|title=The CYP26 inhibitor R115866 potentiates the effects of all-trans retinoic acid on cultured human epidermal keratinocytes|journal=Br J Dermatol|pmid=19120344|volume=160|issue=3|pages=505–13|doi=10.1111/j.1365-2133.2008.08960.x}}</ref>

==References==
{{Reflist}}

[[category:Benzothiazoles]]
[[category:Triazoles]]
{{pharma-stub}}
[[Category:2Fix]]